C22H40O2Si — CID 71770729
(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(1R,2R,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl]hex-3-yn-1-ol (PubChem CID 71770729) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is (1R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(1R,2R,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl]hex-3-yn-1-ol.
| Compound Name | (1R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(1R,2R,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl]hex-3-yn-1-ol |
|---|---|
| PubChem CID | 71770729 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | (1R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(1R,2R,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl]hex-3-yn-1-ol |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)C[C@H]1[C@H](O)CC#C[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O2Si/c1-16(2)19-14-13-17(3)15-20(19)21(23)12-10-11-18(4)24-25(8,9)22(5,6)7/h17-21,23H,1,12-15H2,2-9H3/t17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | GWJRROJTLBUMKW-XDWAVFMPSA-N |
| XLogP | 5.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|