C19H38O2Si — CID 11099464
(1R,2R,5R,6S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dimethyl-5-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 11099464) has the molecular formula C19H38O2Si and a molecular weight of 326.60 g/mol. Its IUPAC name is (1R,2R,5R,6S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dimethyl-5-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | (1R,2R,5R,6S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dimethyl-5-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 11099464 |
| Molecular Formula | C19H38O2Si |
| Molecular Weight | 326.60 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | (1R,2R,5R,6S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dimethyl-5-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)[C@@H]1CC[C@](C)(CCO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1C |
| InChI | InChI=1S/C19H38O2Si/c1-14(2)16-10-11-19(7,17(20)15(16)3)12-13-21-22(8,9)18(4,5)6/h15-17,20H,1,10-13H2,2-9H3/t15-,16-,17+,19+/m0/s1 |
| InChIKey | HWOBXQAHUGUWRK-IMBTUZDBSA-N |
| XLogP | 5.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|