C29H58O3Si2 — CID 11191463
[(1R,4aR,5S,6R,8aS)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5,8a-dimethyl-2-methylidene-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methanol (PubChem CID 11191463) has the molecular formula C29H58O3Si2 and a molecular weight of 510.95 g/mol. Its IUPAC name is [(1R,4aR,5S,6R,8aS)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5,8a-dimethyl-2-methylidene-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methanol.
| Compound Name | [(1R,4aR,5S,6R,8aS)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5,8a-dimethyl-2-methylidene-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 11191463 |
| Molecular Formula | C29H58O3Si2 |
| Molecular Weight | 510.95 g/mol |
| Exact Mass | 510.39 |
| IUPAC Name | [(1R,4aR,5S,6R,8aS)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5,8a-dimethyl-2-methylidene-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methanol |
| SMILES | C=C1CC[C@@H]2[C@](C)(CC[C@@H](O[Si](CC)(CC)CC)[C@@]2(C)CCCO[Si](C)(C)C(C)(C)C)[C@@H]1CO |
| InChI | InChI=1S/C29H58O3Si2/c1-12-34(13-2,14-3)32-26-18-20-28(8)24(22-30)23(4)16-17-25(28)29(26,9)19-15-21-31-33(10,11)27(5,6)7/h24-26,30H,4,12-22H2,1-3,5-11H3/t24-,25-,26-,28-,29+/m1/s1 |
| InChIKey | MIYSAJRUGAIZSA-LCIPZFHYSA-N |
| XLogP | 8.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.95 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|