C20H38O2Si — CID 11290709
(1R,2S,4aS,8aR)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4a-dimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-2-ol (PubChem CID 11290709) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is (1R,2S,4aS,8aR)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4a-dimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-2-ol.
| Compound Name | (1R,2S,4aS,8aR)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4a-dimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 11290709 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (1R,2S,4aS,8aR)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4a-dimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-2-ol |
| SMILES | C=C1CCC[C@H]2[C@](C)(CO[Si](C)(C)C(C)(C)C)[C@@H](O)CC[C@]12C |
| InChI | InChI=1S/C20H38O2Si/c1-15-10-9-11-16-19(15,5)13-12-17(21)20(16,6)14-22-23(7,8)18(2,3)4/h16-17,21H,1,9-14H2,2-8H3/t16-,17+,19-,20+/m1/s1 |
| InChIKey | FXWNUZJDRGYLAK-BWPNAZKDSA-N |
| XLogP | 5.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|