C23H46O2Si — CID 101356333
(E,1R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]hex-2-en-1-ol (PubChem CID 101356333) has the molecular formula C23H46O2Si and a molecular weight of 382.71 g/mol. Its IUPAC name is (E,1R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]hex-2-en-1-ol.
| Compound Name | (E,1R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]hex-2-en-1-ol |
|---|---|
| PubChem CID | 101356333 |
| Molecular Formula | C23H46O2Si |
| Molecular Weight | 382.71 g/mol |
| Exact Mass | 382.33 |
| IUPAC Name | (E,1R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]hex-2-en-1-ol |
| SMILES | C/C(=C\[C@H](O)[C@@H]1C[C@H](C)CC[C@H]1C(C)C)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O2Si/c1-17(2)20-13-12-19(4)15-21(20)22(24)16-18(3)11-10-14-25-26(8,9)23(5,6)7/h16-17,19-22,24H,10-15H2,1-9H3/b18-16+/t19-,20+,21-,22+/m1/s1 |
| InChIKey | MMNNBDTUUDATLF-CQDVRXCBSA-N |
| XLogP | 6.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.71 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|