C28H21N3 — CID 10222571
3-[5-phenyl-5-(4-phenylphenyl)-1,4-dihydroimidazol-2-yl]benzonitrile (PubChem CID 10222571) has the molecular formula C28H21N3 and a molecular weight of 399.50 g/mol. Its IUPAC name is 3-[5-phenyl-5-(4-phenylphenyl)-1,4-dihydroimidazol-2-yl]benzonitrile.
| Compound Name | 3-[5-phenyl-5-(4-phenylphenyl)-1,4-dihydroimidazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 10222571 |
| Molecular Formula | C28H21N3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 3-[5-phenyl-5-(4-phenylphenyl)-1,4-dihydroimidazol-2-yl]benzonitrile |
| SMILES | N#Cc1cccc(C2=NCC(c3ccccc3)(c3ccc(-c4ccccc4)cc3)N2)c1 |
| InChI | InChI=1S/C28H21N3/c29-19-21-8-7-11-24(18-21)27-30-20-28(31-27,25-12-5-2-6-13-25)26-16-14-23(15-17-26)22-9-3-1-4-10-22/h1-18H,20H2,(H,30,31) |
| InChIKey | WBFFMNLFUDZOLH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |