C21H14ClFN4 — CID 10199565
3-[5-(6-chloro-2-pyridinyl)-5-(4-fluorophenyl)-1,4-dihydroimidazol-2-yl]benzonitrile (PubChem CID 10199565) has the molecular formula C21H14ClFN4 and a molecular weight of 376.82 g/mol. Its IUPAC name is 3-[5-(6-chloro-2-pyridinyl)-5-(4-fluorophenyl)-1,4-dihydroimidazol-2-yl]benzonitrile.
| Compound Name | 3-[5-(6-chloro-2-pyridinyl)-5-(4-fluorophenyl)-1,4-dihydroimidazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 10199565 |
| Molecular Formula | C21H14ClFN4 |
| Molecular Weight | 376.82 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 3-[5-(6-chloro-2-pyridinyl)-5-(4-fluorophenyl)-1,4-dihydroimidazol-2-yl]benzonitrile |
| SMILES | N#Cc1cccc(C2=NCC(c3ccc(F)cc3)(c3cccc(Cl)n3)N2)c1 |
| InChI | InChI=1S/C21H14ClFN4/c22-19-6-2-5-18(26-19)21(16-7-9-17(23)10-8-16)13-25-20(27-21)15-4-1-3-14(11-15)12-24/h1-11H,13H2,(H,25,27) |
| InChIKey | MZMUNIVAKJJSLR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 61.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.82 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|