C21H20N4 — CID 102226472
2-butyl-3-phenylpyrido[4,3-b]quinoxalin-1-imine (PubChem CID 102226472) has the molecular formula C21H20N4 and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-butyl-3-phenylpyrido[4,3-b]quinoxalin-1-imine.
| Compound Name | 2-butyl-3-phenylpyrido[4,3-b]quinoxalin-1-imine |
|---|---|
| PubChem CID | 102226472 |
| Molecular Formula | C21H20N4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2-butyl-3-phenylpyrido[4,3-b]quinoxalin-1-imine |
| SMILES | [H]/N=c1\c2nc3ccccc3nc2cc(-c2ccccc2)n1CCCC |
| InChI | InChI=1S/C21H20N4/c1-2-3-13-25-19(15-9-5-4-6-10-15)14-18-20(21(25)22)24-17-12-8-7-11-16(17)23-18/h4-12,14,22H,2-3,13H2,1H3/b22-21+ |
| InChIKey | AEKRLLNEEKYHPZ-QURGRASLSA-N |
| XLogP | 4.53 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|