C18H25N4+ — CID 22921452
1,3-dibutyl-2-methylimidazo[4,5-b]quinoxalin-3-ium (PubChem CID 22921452) has the molecular formula C18H25N4+ and a molecular weight of 297.43 g/mol. Its IUPAC name is 1,3-dibutyl-2-methylimidazo[4,5-b]quinoxalin-3-ium.
| Compound Name | 1,3-dibutyl-2-methylimidazo[4,5-b]quinoxalin-3-ium |
|---|---|
| PubChem CID | 22921452 |
| Molecular Formula | C18H25N4+ |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 1,3-dibutyl-2-methylimidazo[4,5-b]quinoxalin-3-ium |
| SMILES | CCCCn1c(C)[n+](CCCC)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C18H25N4/c1-4-6-12-21-14(3)22(13-7-5-2)18-17(21)19-15-10-8-9-11-16(15)20-18/h8-11H,4-7,12-13H2,1-3H3/q+1 |
| InChIKey | VAXCPASSOJAJPQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|