C18H10N2OS — CID 102226712
5-methyl-6-thia-9,19-diazapentacyclo[10.7.1.03,7.08,20.013,18]icosa-1(19),3(7),4,8,10,12(20),13,15,17-nonaen-2-one (PubChem CID 102226712) has the molecular formula C18H10N2OS and a molecular weight of 302.36 g/mol. Its IUPAC name is 5-methyl-6-thia-9,19-diazapentacyclo[10.7.1.03,7.08,20.013,18]icosa-1(19),3(7),4,8,10,12(20),13,15,17-nonaen-2-one.
| Compound Name | 5-methyl-6-thia-9,19-diazapentacyclo[10.7.1.03,7.08,20.013,18]icosa-1(19),3(7),4,8,10,12(20),13,15,17-nonaen-2-one |
|---|---|
| PubChem CID | 102226712 |
| Molecular Formula | C18H10N2OS |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 5-methyl-6-thia-9,19-diazapentacyclo[10.7.1.03,7.08,20.013,18]icosa-1(19),3(7),4,8,10,12(20),13,15,17-nonaen-2-one |
| SMILES | Cc1cc2c(s1)-c1nccc3c1c(nc1ccccc13)C2=O |
| InChI | InChI=1S/C18H10N2OS/c1-9-8-12-17(21)15-14-11(6-7-19-16(14)18(12)22-9)10-4-2-3-5-13(10)20-15/h2-8H,1H3 |
| InChIKey | AWSOVPSTJDWVOH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|