C22H24N2O2 — CID 102227513
ethyl (6R,6aR)-6-phenyl-6,6a,7,8,9,11-hexahydro-5H-benzo[b][1,4]benzodiazepine-10-carboxylate (PubChem CID 102227513) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is ethyl (6R,6aR)-6-phenyl-6,6a,7,8,9,11-hexahydro-5H-benzo[b][1,4]benzodiazepine-10-carboxylate.
| Compound Name | ethyl (6R,6aR)-6-phenyl-6,6a,7,8,9,11-hexahydro-5H-benzo[b][1,4]benzodiazepine-10-carboxylate |
|---|---|
| PubChem CID | 102227513 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | ethyl (6R,6aR)-6-phenyl-6,6a,7,8,9,11-hexahydro-5H-benzo[b][1,4]benzodiazepine-10-carboxylate |
| SMILES | CCOC(=O)C1=C2Nc3ccccc3N[C@@H](c3ccccc3)[C@H]2CCC1 |
| InChI | InChI=1S/C22H24N2O2/c1-2-26-22(25)17-12-8-11-16-20(15-9-4-3-5-10-15)23-18-13-6-7-14-19(18)24-21(16)17/h3-7,9-10,13-14,16,20,23-24H,2,8,11-12H2,1H3/t16-,20+/m1/s1 |
| InChIKey | HUEIFEAZLMNGNO-UZLBHIALSA-N |
| XLogP | 4.88 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |