C22H23NO3 — CID 11581081
ethyl (3S,8aS)-3,5-diphenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate (PubChem CID 11581081) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is ethyl (3S,8aS)-3,5-diphenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate.
| Compound Name | ethyl (3S,8aS)-3,5-diphenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 11581081 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | ethyl (3S,8aS)-3,5-diphenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N2[C@H](CC1)OC[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C22H23NO3/c1-2-25-22(24)18-13-14-20-23(21(18)17-11-7-4-8-12-17)19(15-26-20)16-9-5-3-6-10-16/h3-12,19-20H,2,13-15H2,1H3/t19-,20+/m1/s1 |
| InChIKey | BJQJWQKMJXVNOV-UXHICEINSA-N |
| XLogP | 4.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |