C15H26O3 — CID 102228759
(3S,6S)-6-[(4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2,2,6-trimethyloxan-3-ol (PubChem CID 102228759) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (3S,6S)-6-[(4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2,2,6-trimethyloxan-3-ol.
| Compound Name | (3S,6S)-6-[(4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2,2,6-trimethyloxan-3-ol |
|---|---|
| PubChem CID | 102228759 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (3S,6S)-6-[(4S)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2,2,6-trimethyloxan-3-ol |
| SMILES | CC1(C)O[C@](C)(C2C=C[C@@](C)(O)CC2)CC[C@@H]1O |
| InChI | InChI=1S/C15H26O3/c1-13(2)12(16)7-10-15(4,18-13)11-5-8-14(3,17)9-6-11/h5,8,11-12,16-17H,6-7,9-10H2,1-4H3/t11?,12-,14+,15-/m0/s1 |
| InChIKey | FUFCOMVTKVHPIF-IQVOKHDLSA-N |
| XLogP | 2.41 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|