C25H17FN2O2 — CID 102230062
2-(2,6-dimethylphenyl)-4-(4-fluorophenyl)pyrrolo[3,4-c]quinoline-1,3-dione (PubChem CID 102230062) has the molecular formula C25H17FN2O2 and a molecular weight of 396.42 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-4-(4-fluorophenyl)pyrrolo[3,4-c]quinoline-1,3-dione.
| Compound Name | 2-(2,6-dimethylphenyl)-4-(4-fluorophenyl)pyrrolo[3,4-c]quinoline-1,3-dione |
|---|---|
| PubChem CID | 102230062 |
| Molecular Formula | C25H17FN2O2 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-4-(4-fluorophenyl)pyrrolo[3,4-c]quinoline-1,3-dione |
| SMILES | Cc1cccc(C)c1N1C(=O)c2c(-c3ccc(F)cc3)nc3ccccc3c2C1=O |
| InChI | InChI=1S/C25H17FN2O2/c1-14-6-5-7-15(2)23(14)28-24(29)20-18-8-3-4-9-19(18)27-22(21(20)25(28)30)16-10-12-17(26)13-11-16/h3-13H,1-2H3 |
| InChIKey | ZQKPZWHHXYMFHI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|