C24H16N2O2 — CID 71819080
8-methyl-2,4-diphenylpyrrolo[3,4-c]quinoline-1,3-dione (PubChem CID 71819080) has the molecular formula C24H16N2O2 and a molecular weight of 364.40 g/mol. Its IUPAC name is 8-methyl-2,4-diphenylpyrrolo[3,4-c]quinoline-1,3-dione.
| Compound Name | 8-methyl-2,4-diphenylpyrrolo[3,4-c]quinoline-1,3-dione |
|---|---|
| PubChem CID | 71819080 |
| Molecular Formula | C24H16N2O2 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 8-methyl-2,4-diphenylpyrrolo[3,4-c]quinoline-1,3-dione |
| SMILES | Cc1ccc2nc(-c3ccccc3)c3c(c2c1)C(=O)N(c1ccccc1)C3=O |
| InChI | InChI=1S/C24H16N2O2/c1-15-12-13-19-18(14-15)20-21(22(25-19)16-8-4-2-5-9-16)24(28)26(23(20)27)17-10-6-3-7-11-17/h2-14H,1H3 |
| InChIKey | RZCLPBQMHYOCKD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|