C19H17N — CID 135030288
8-methyl-4-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline (PubChem CID 135030288) has the molecular formula C19H17N and a molecular weight of 259.35 g/mol. Its IUPAC name is 8-methyl-4-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline.
| Compound Name | 8-methyl-4-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 135030288 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 8-methyl-4-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline |
| SMILES | Cc1ccc2nc(-c3ccccc3)c3c(c2c1)CCC3 |
| InChI | InChI=1S/C19H17N/c1-13-10-11-18-17(12-13)15-8-5-9-16(15)19(20-18)14-6-3-2-4-7-14/h2-4,6-7,10-12H,5,8-9H2,1H3 |
| InChIKey | OFFJEOPSMXEZND-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |