C23H28N4O3 — CID 10223172
7-[4-(methoxymethyl)phenyl]-1'-pyridin-4-ylspiro[3,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-5-one (PubChem CID 10223172) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 7-[4-(methoxymethyl)phenyl]-1'-pyridin-4-ylspiro[3,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-5-one.
| Compound Name | 7-[4-(methoxymethyl)phenyl]-1'-pyridin-4-ylspiro[3,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-5-one |
|---|---|
| PubChem CID | 10223172 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 7-[4-(methoxymethyl)phenyl]-1'-pyridin-4-ylspiro[3,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-5-one |
| SMILES | COCc1ccc(N2CC(=O)N3CC4(CCN(c5ccncc5)CC4)OC3C2)cc1 |
| InChI | InChI=1S/C23H28N4O3/c1-29-16-18-2-4-19(5-3-18)26-14-21(28)27-17-23(30-22(27)15-26)8-12-25(13-9-23)20-6-10-24-11-7-20/h2-7,10-11,22H,8-9,12-17H2,1H3 |
| InChIKey | DSIYBLLZSHRFMJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|