C22H25BrN4O2S — CID 142152034
7-(4-bromophenyl)sulfanyl-1'-(pyridin-4-ylmethyl)spiro[3,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-5-one (PubChem CID 142152034) has the molecular formula C22H25BrN4O2S and a molecular weight of 489.44 g/mol. Its IUPAC name is 7-(4-bromophenyl)sulfanyl-1'-(pyridin-4-ylmethyl)spiro[3,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-5-one.
| Compound Name | 7-(4-bromophenyl)sulfanyl-1'-(pyridin-4-ylmethyl)spiro[3,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-5-one |
|---|---|
| PubChem CID | 142152034 |
| Molecular Formula | C22H25BrN4O2S |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 7-(4-bromophenyl)sulfanyl-1'-(pyridin-4-ylmethyl)spiro[3,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-5-one |
| SMILES | O=C1CN(Sc2ccc(Br)cc2)CC2OC3(CCN(Cc4ccncc4)CC3)CN12 |
| InChI | InChI=1S/C22H25BrN4O2S/c23-18-1-3-19(4-2-18)30-26-14-20(28)27-16-22(29-21(27)15-26)7-11-25(12-8-22)13-17-5-9-24-10-6-17/h1-6,9-10,21H,7-8,11-16H2 |
| InChIKey | VWBQEBQWUGGVBH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|