C20H26N4O3 — CID 10292582
7-benzyl-1'-(4,5-dihydro-1,3-oxazol-2-yl)spiro[3,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-5-one (PubChem CID 10292582) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 7-benzyl-1'-(4,5-dihydro-1,3-oxazol-2-yl)spiro[3,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-5-one.
| Compound Name | 7-benzyl-1'-(4,5-dihydro-1,3-oxazol-2-yl)spiro[3,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-5-one |
|---|---|
| PubChem CID | 10292582 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 7-benzyl-1'-(4,5-dihydro-1,3-oxazol-2-yl)spiro[3,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-5-one |
| SMILES | O=C1CN(Cc2ccccc2)CC2OC3(CCN(C4=NCCO4)CC3)CN12 |
| InChI | InChI=1S/C20H26N4O3/c25-17-13-22(12-16-4-2-1-3-5-16)14-18-24(17)15-20(27-18)6-9-23(10-7-20)19-21-8-11-26-19/h1-5,18H,6-15H2 |
| InChIKey | IRGRFVMBFSTQTG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |