C21H28N2O2 — CID 26314217
(4aR,9aS,9bR)-1'-benzylspiro[3,4,4a,7,8,9,9a,9b-octahydropyrano[3,4-a]pyrrolizine-5,4'-piperidine]-1-one (PubChem CID 26314217) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is (4aR,9aS,9bR)-1'-benzylspiro[3,4,4a,7,8,9,9a,9b-octahydropyrano[3,4-a]pyrrolizine-5,4'-piperidine]-1-one.
| Compound Name | (4aR,9aS,9bR)-1'-benzylspiro[3,4,4a,7,8,9,9a,9b-octahydropyrano[3,4-a]pyrrolizine-5,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 26314217 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (4aR,9aS,9bR)-1'-benzylspiro[3,4,4a,7,8,9,9a,9b-octahydropyrano[3,4-a]pyrrolizine-5,4'-piperidine]-1-one |
| SMILES | O=C1OCC[C@@H]2[C@@H]1[C@@H]1CCCN1C21CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H28N2O2/c24-20-19-17(8-14-25-20)21(23-11-4-7-18(19)23)9-12-22(13-10-21)15-16-5-2-1-3-6-16/h1-3,5-6,17-19H,4,7-15H2/t17-,18+,19-/m1/s1 |
| InChIKey | QTWXGPYSKRWGJN-CEXWTWQISA-N |
| XLogP | 2.68 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |