C15H19FN4O2 — CID 70037773
1'-(3-fluoro-4-pyridinyl)spiro[6,7,8,8a-tetrahydro-3H-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-5-one (PubChem CID 70037773) has the molecular formula C15H19FN4O2 and a molecular weight of 306.34 g/mol. Its IUPAC name is 1'-(3-fluoro-4-pyridinyl)spiro[6,7,8,8a-tetrahydro-3H-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-5-one.
| Compound Name | 1'-(3-fluoro-4-pyridinyl)spiro[6,7,8,8a-tetrahydro-3H-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-5-one |
|---|---|
| PubChem CID | 70037773 |
| Molecular Formula | C15H19FN4O2 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 1'-(3-fluoro-4-pyridinyl)spiro[6,7,8,8a-tetrahydro-3H-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-5-one |
| SMILES | O=C1CNCC2OC3(CCN(c4ccncc4F)CC3)CN12 |
| InChI | InChI=1S/C15H19FN4O2/c16-11-7-17-4-1-12(11)19-5-2-15(3-6-19)10-20-13(21)8-18-9-14(20)22-15/h1,4,7,14,18H,2-3,5-6,8-10H2 |
| InChIKey | BMHWLTYWSHXYPF-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |