C28H32N2O2 — CID 102232279
4-[(E)-2-[2,5-dibutoxy-4-[(E)-2-pyridin-4-ylethenyl]phenyl]ethenyl]pyridine (PubChem CID 102232279) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 4-[(E)-2-[2,5-dibutoxy-4-[(E)-2-pyridin-4-ylethenyl]phenyl]ethenyl]pyridine.
| Compound Name | 4-[(E)-2-[2,5-dibutoxy-4-[(E)-2-pyridin-4-ylethenyl]phenyl]ethenyl]pyridine |
|---|---|
| PubChem CID | 102232279 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 4-[(E)-2-[2,5-dibutoxy-4-[(E)-2-pyridin-4-ylethenyl]phenyl]ethenyl]pyridine |
| SMILES | CCCCOc1cc(/C=C/c2ccncc2)c(OCCCC)cc1/C=C/c1ccncc1 |
| InChI | InChI=1S/C28H32N2O2/c1-3-5-19-31-27-21-26(10-8-24-13-17-30-18-14-24)28(32-20-6-4-2)22-25(27)9-7-23-11-15-29-16-12-23/h7-18,21-22H,3-6,19-20H2,1-2H3/b9-7+,10-8+ |
| InChIKey | WCNFUNIQLMMCBI-FIFLTTCUSA-N |
| XLogP | 7.18 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|