C21H21NO2Si — CID 102232575
4-benzyl-2-phenyl-4-(2-trimethylsilylethynyl)-1,3-oxazol-5-one (PubChem CID 102232575) has the molecular formula C21H21NO2Si and a molecular weight of 347.49 g/mol. Its IUPAC name is 4-benzyl-2-phenyl-4-(2-trimethylsilylethynyl)-1,3-oxazol-5-one.
| Compound Name | 4-benzyl-2-phenyl-4-(2-trimethylsilylethynyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 102232575 |
| Molecular Formula | C21H21NO2Si |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-benzyl-2-phenyl-4-(2-trimethylsilylethynyl)-1,3-oxazol-5-one |
| SMILES | C[Si](C)(C)C#CC1(Cc2ccccc2)N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C21H21NO2Si/c1-25(2,3)15-14-21(16-17-10-6-4-7-11-17)20(23)24-19(22-21)18-12-8-5-9-13-18/h4-13H,16H2,1-3H3 |
| InChIKey | PNCYDWKQHKRMEZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|