About (4S)-4-benzyl-2-(3,5-dinitrophenyl)-4-ethyl-1,3-oxazol-5-one
(4S)-4-benzyl-2-(3,5-dinitrophenyl)-4-ethyl-1,3-oxazol-5-one (PubChem CID 54401619) has the molecular formula C18H15N3O6
and a molecular weight of 369.33 g/mol. Its IUPAC name is (4S)-4-benzyl-2-(3,5-dinitrophenyl)-4-ethyl-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | (4S)-4-benzyl-2-(3,5-dinitrophenyl)-4-ethyl-1,3-oxazol-5-one |
| PubChem CID | 54401619 |
| Molecular Formula | C18H15N3O6 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (4S)-4-benzyl-2-(3,5-dinitrophenyl)-4-ethyl-1,3-oxazol-5-one |
| SMILES | CC[C@@]1(Cc2ccccc2)N=C(c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)OC1=O |
| InChI | InChI=1S/C18H15N3O6/c1-2-18(11-12-6-4-3-5-7-12)17(22)27-16(19-18)13-8-14(20(23)24)10-15(9-13)21(25)26/h3-10H,2,11H2,1H3/t18-/m0/s1 |
| InChIKey | VNUZSCAJDLKZPX-SFHVURJKSA-N |
| XLogP | 3.20 |
| TPSA | 124.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-benzyl-2-(3,5-dinitrophenyl)-4-ethyl-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-benzyl-2-(3,5-dinitrophenyl)-4-ethyl-1,3-oxazol-5-one?
The IUPAC name of (4S)-4-benzyl-2-(3,5-dinitrophenyl)-4-ethyl-1,3-oxazol-5-one (CID 54401619) is (4S)-4-benzyl-2-(3,5-dinitrophenyl)-4-ethyl-1,3-oxazol-5-one.
What is the SMILES notation for (4S)-4-benzyl-2-(3,5-dinitrophenyl)-4-ethyl-1,3-oxazol-5-one?
The canonical SMILES for (4S)-4-benzyl-2-(3,5-dinitrophenyl)-4-ethyl-1,3-oxazol-5-one is CC[C@@]1(Cc2ccccc2)N=C(c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)OC1=O.
What is the InChIKey of (4S)-4-benzyl-2-(3,5-dinitrophenyl)-4-ethyl-1,3-oxazol-5-one?
The InChIKey is VNUZSCAJDLKZPX-SFHVURJKSA-N. The full InChI is InChI=1S/C18H15N3O6/c1-2-18(11-12-6-4-3-5-7-12)17(22)27-16(19-18)13-8-14(20(23)24)10-15(9-13)21(25)26/h3-10H,2,11H2,1H3/t18-/m0/s1.
What are the key properties of (4S)-4-benzyl-2-(3,5-dinitrophenyl)-4-ethyl-1,3-oxazol-5-one?
(4S)-4-benzyl-2-(3,5-dinitrophenyl)-4-ethyl-1,3-oxazol-5-one has a molecular weight of 369.33 g/mol, XLogP of 3.20, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-benzyl-2-(3,5-dinitrophenyl)-4-ethyl-1,3-oxazol-5-one is sourced from PubChem (CID 54401619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).