C25H27FN2O4 — CID 11847406
4-[(Z)-2-fluorodec-2-enyl]-2-(4-nitrophenyl)-4-phenyl-1,3-oxazol-5-one (PubChem CID 11847406) has the molecular formula C25H27FN2O4 and a molecular weight of 438.50 g/mol. Its IUPAC name is 4-[(Z)-2-fluorodec-2-enyl]-2-(4-nitrophenyl)-4-phenyl-1,3-oxazol-5-one.
| Compound Name | 4-[(Z)-2-fluorodec-2-enyl]-2-(4-nitrophenyl)-4-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 11847406 |
| Molecular Formula | C25H27FN2O4 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 4-[(Z)-2-fluorodec-2-enyl]-2-(4-nitrophenyl)-4-phenyl-1,3-oxazol-5-one |
| SMILES | CCCCCCC/C=C(\F)CC1(c2ccccc2)N=C(c2ccc([N+](=O)[O-])cc2)OC1=O |
| InChI | InChI=1S/C25H27FN2O4/c1-2-3-4-5-6-10-13-21(26)18-25(20-11-8-7-9-12-20)24(29)32-23(27-25)19-14-16-22(17-15-19)28(30)31/h7-9,11-17H,2-6,10,18H2,1H3/b21-13- |
| InChIKey | PNBNPSKEVHLPAT-BKUYFWCQSA-N |
| XLogP | 6.40 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|