C27H26N2O2 — CID 10223289
methyl 2-[3-(6-propan-2-ylquinolin-8-yl)phenyl]-3-pyridin-4-ylpropanoate (PubChem CID 10223289) has the molecular formula C27H26N2O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is methyl 2-[3-(6-propan-2-ylquinolin-8-yl)phenyl]-3-pyridin-4-ylpropanoate.
| Compound Name | methyl 2-[3-(6-propan-2-ylquinolin-8-yl)phenyl]-3-pyridin-4-ylpropanoate |
|---|---|
| PubChem CID | 10223289 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | methyl 2-[3-(6-propan-2-ylquinolin-8-yl)phenyl]-3-pyridin-4-ylpropanoate |
| SMILES | COC(=O)C(Cc1ccncc1)c1cccc(-c2cc(C(C)C)cc3cccnc23)c1 |
| InChI | InChI=1S/C27H26N2O2/c1-18(2)23-16-22-8-5-11-29-26(22)24(17-23)20-6-4-7-21(15-20)25(27(30)31-3)14-19-9-12-28-13-10-19/h4-13,15-18,25H,14H2,1-3H3 |
| InChIKey | LWNBZGDZQHQEIU-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |