C22H24O4S10 — CID 102232924
dimethyl 2-[5-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 102232924) has the molecular formula C22H24O4S10 and a molecular weight of 673.10 g/mol. Its IUPAC name is dimethyl 2-[5-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[5-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102232924 |
| Molecular Formula | C22H24O4S10 |
| Molecular Weight | 673.10 g/mol |
| Exact Mass | 671.89 |
| IUPAC Name | dimethyl 2-[5-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | CCCCSC1=C(SCCCC)SC(=C2SC3=C(S2)SC(=C2SC(C(=O)OC)=C(C(=O)OC)S2)S3)S1 |
| InChI | InChI=1S/C22H24O4S10/c1-5-7-9-27-15-16(28-10-8-6-2)32-19(31-15)20-35-21-22(36-20)34-18(33-21)17-29-11(13(23)25-3)12(30-17)14(24)26-4/h5-10H2,1-4H3 |
| InChIKey | CPEQAMJBBJBNKO-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.10 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|