C18H16O8S8 — CID 20727639
dimethyl 2-[2-[4,5-bis(methylperoxymethyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-ylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 20727639) has the molecular formula C18H16O8S8 and a molecular weight of 616.85 g/mol. Its IUPAC name is dimethyl 2-[2-[4,5-bis(methylperoxymethyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-ylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[2-[4,5-bis(methylperoxymethyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-ylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 20727639 |
| Molecular Formula | C18H16O8S8 |
| Molecular Weight | 616.85 g/mol |
| Exact Mass | 615.86 |
| IUPAC Name | dimethyl 2-[2-[4,5-bis(methylperoxymethyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-ylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COOCC1=C(COOC)SC(=C2SC3=C(S2)SC(=C2SC(C(=O)OC)=C(C(=O)OC)S2)S3)S1 |
| InChI | InChI=1S/C18H16O8S8/c1-21-11(19)9-10(12(20)22-2)30-14(29-9)16-33-17-18(34-16)32-15(31-17)13-27-7(5-25-23-3)8(28-13)6-26-24-4/h5-6H2,1-4H3 |
| InChIKey | CLRYTPQZVHJRCW-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.85 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|