C23H20O8S12 — CID 102300428
dimethyl 2-[4-[[2-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-5-methylsulfanyl-1,3-dithiol-4-yl]sulfanylmethylsulfanyl]-5-methylsulfanyl-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 102300428) has the molecular formula C23H20O8S12 and a molecular weight of 809.21 g/mol. Its IUPAC name is dimethyl 2-[4-[[2-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-5-methylsulfanyl-1,3-dithiol-4-yl]sulfanylmethylsulfanyl]-5-methylsulfanyl-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[4-[[2-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-5-methylsulfanyl-1,3-dithiol-4-yl]sulfanylmethylsulfanyl]-5-methylsulfanyl-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102300428 |
| Molecular Formula | C23H20O8S12 |
| Molecular Weight | 809.21 g/mol |
| Exact Mass | 807.78 |
| IUPAC Name | dimethyl 2-[4-[[2-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-5-methylsulfanyl-1,3-dithiol-4-yl]sulfanylmethylsulfanyl]-5-methylsulfanyl-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2SC(SC)=C(SCSC3=C(SC)SC(=C4SC(C(=O)OC)=C(C(=O)OC)S4)S3)S2)S1 |
| InChI | InChI=1S/C23H20O8S12/c1-28-12(24)8-9(13(25)29-2)37-20(36-8)22-40-16(32-5)18(42-22)34-7-35-19-17(33-6)41-23(43-19)21-38-10(14(26)30-3)11(39-21)15(27)31-4/h7H2,1-6H3 |
| InChIKey | JWNPWBMKNOZSIO-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.21 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|