C24H22BrNO3 — CID 102235381
(3E,4R)-1-benzyl-3-(3-bromo-1-phenylprop-2-ynylidene)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)azetidin-2-one (PubChem CID 102235381) has the molecular formula C24H22BrNO3 and a molecular weight of 452.35 g/mol. Its IUPAC name is (3E,4R)-1-benzyl-3-(3-bromo-1-phenylprop-2-ynylidene)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)azetidin-2-one.
| Compound Name | (3E,4R)-1-benzyl-3-(3-bromo-1-phenylprop-2-ynylidene)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)azetidin-2-one |
|---|---|
| PubChem CID | 102235381 |
| Molecular Formula | C24H22BrNO3 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | (3E,4R)-1-benzyl-3-(3-bromo-1-phenylprop-2-ynylidene)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)azetidin-2-one |
| SMILES | CC1(C)OCC([C@H]2/C(=C(\C#CBr)c3ccccc3)C(=O)N2Cc2ccccc2)O1 |
| InChI | InChI=1S/C24H22BrNO3/c1-24(2)28-16-20(29-24)22-21(19(13-14-25)18-11-7-4-8-12-18)23(27)26(22)15-17-9-5-3-6-10-17/h3-12,20,22H,15-16H2,1-2H3/b21-19-/t20?,22-/m0/s1 |
| InChIKey | UUPQXRRNPMVGFH-APIUMAEVSA-N |
| XLogP | 4.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|