C23H25NO3 — CID 134835108
(4S)-1-benzhydryl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethylideneazetidin-2-one (PubChem CID 134835108) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is (4S)-1-benzhydryl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethylideneazetidin-2-one.
| Compound Name | (4S)-1-benzhydryl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethylideneazetidin-2-one |
|---|---|
| PubChem CID | 134835108 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (4S)-1-benzhydryl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethylideneazetidin-2-one |
| SMILES | CC=C1C(=O)N(C(c2ccccc2)c2ccccc2)[C@@H]1[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C23H25NO3/c1-4-18-21(19-15-26-23(2,3)27-19)24(22(18)25)20(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h4-14,19-21H,15H2,1-3H3/t19-,21-/m0/s1 |
| InChIKey | IBBFRGRXGNPNGU-FPOVZHCZSA-N |
| XLogP | 4.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|