C24H29NO6S — CID 134835017
[(1S)-1-[(2S,3S)-1-benzhydryl-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxoazetidin-3-yl]ethyl] methanesulfonate (PubChem CID 134835017) has the molecular formula C24H29NO6S and a molecular weight of 459.56 g/mol. Its IUPAC name is [(1S)-1-[(2S,3S)-1-benzhydryl-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxoazetidin-3-yl]ethyl] methanesulfonate.
| Compound Name | [(1S)-1-[(2S,3S)-1-benzhydryl-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxoazetidin-3-yl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 134835017 |
| Molecular Formula | C24H29NO6S |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | [(1S)-1-[(2S,3S)-1-benzhydryl-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxoazetidin-3-yl]ethyl] methanesulfonate |
| SMILES | C[C@H](OS(C)(=O)=O)[C@H]1C(=O)N(C(c2ccccc2)c2ccccc2)[C@@H]1[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C24H29NO6S/c1-16(31-32(4,27)28)20-22(19-15-29-24(2,3)30-19)25(23(20)26)21(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,16,19-22H,15H2,1-4H3/t16-,19-,20+,22+/m0/s1 |
| InChIKey | IFXNJINHHFJGHD-VRBBWPEWSA-N |
| XLogP | 3.12 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|