C23H25NO4 — CID 53391674
(3S,4S)-3-acetyl-1-benzhydryl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]azetidin-2-one (PubChem CID 53391674) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is (3S,4S)-3-acetyl-1-benzhydryl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]azetidin-2-one.
| Compound Name | (3S,4S)-3-acetyl-1-benzhydryl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]azetidin-2-one |
|---|---|
| PubChem CID | 53391674 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | (3S,4S)-3-acetyl-1-benzhydryl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]azetidin-2-one |
| SMILES | CC(=O)[C@H]1C(=O)N(C(c2ccccc2)c2ccccc2)[C@@H]1[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C23H25NO4/c1-15(25)19-21(18-14-27-23(2,3)28-18)24(22(19)26)20(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,18-21H,14H2,1-3H3/t18-,19+,21+/m0/s1 |
| InChIKey | CXLVTTKZPKQGDD-QKNQBKEWSA-N |
| XLogP | 3.34 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|