C19H20N6S — CID 102236135
[(Z)-[4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]thiourea (PubChem CID 102236135) has the molecular formula C19H20N6S and a molecular weight of 364.48 g/mol. Its IUPAC name is [(Z)-[4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]thiourea.
| Compound Name | [(Z)-[4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 102236135 |
| Molecular Formula | C19H20N6S |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [(Z)-[4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]thiourea |
| SMILES | Cc1c(/N=C/c2ccccc2)/c(=N/NC(N)=S)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C19H20N6S/c1-14-17(21-13-15-9-5-3-6-10-15)18(22-23-19(20)26)25(24(14)2)16-11-7-4-8-12-16/h3-13H,1-2H3,(H3,20,23,26)/b21-13+,22-18- |
| InChIKey | YTRHVDJHIGETTC-PGZWDHPLSA-N |
| XLogP | 2.52 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|