C24H20CoN4S2 — CID 10961957
cobalt(2+);2-[[1,5-dimethyl-2-phenyl-3-(2-sulfidophenyl)iminopyrazol-4-yl]iminomethyl]benzenethiolate (PubChem CID 10961957) has the molecular formula C24H20CoN4S2 and a molecular weight of 487.52 g/mol. Its IUPAC name is cobalt(2+);2-[[1,5-dimethyl-2-phenyl-3-(2-sulfidophenyl)iminopyrazol-4-yl]iminomethyl]benzenethiolate.
| Compound Name | cobalt(2+);2-[[1,5-dimethyl-2-phenyl-3-(2-sulfidophenyl)iminopyrazol-4-yl]iminomethyl]benzenethiolate |
|---|---|
| PubChem CID | 10961957 |
| Molecular Formula | C24H20CoN4S2 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | cobalt(2+);2-[[1,5-dimethyl-2-phenyl-3-(2-sulfidophenyl)iminopyrazol-4-yl]iminomethyl]benzenethiolate |
| SMILES | Cc1c(/N=C/c2ccccc2[S-])/c(=N/c2ccccc2[S-])n(-c2ccccc2)n1C.[Co+2] |
| InChI | InChI=1S/C24H22N4S2.Co/c1-17-23(25-16-18-10-6-8-14-21(18)29)24(26-20-13-7-9-15-22(20)30)28(27(17)2)19-11-4-3-5-12-19;/h3-16,29-30H,1-2H3;/q;+2/p-2/b25-16+,26-24-; |
| InChIKey | GAVUPRUQPRPAAY-VRVPAKNJSA-L |
| XLogP | 4.92 |
| TPSA | 34.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|