C22H24N4O2Zn — CID 135450838
2-[[4-[[(Z)-4-hydroxypent-3-en-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]phenol;zinc (PubChem CID 135450838) has the molecular formula C22H24N4O2Zn and a molecular weight of 441.85 g/mol. Its IUPAC name is 2-[[4-[[(Z)-4-hydroxypent-3-en-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]phenol;zinc.
| Compound Name | 2-[[4-[[(Z)-4-hydroxypent-3-en-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]phenol;zinc |
|---|---|
| PubChem CID | 135450838 |
| Molecular Formula | C22H24N4O2Zn |
| Molecular Weight | 441.85 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 2-[[4-[[(Z)-4-hydroxypent-3-en-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]phenol;zinc |
| SMILES | C/C(O)=C/C(C)=N/c1c(C)n(C)n(-c2ccccc2)/c1=N\c1ccccc1O.[Zn] |
| InChI | InChI=1S/C22H24N4O2.Zn/c1-15(14-16(2)27)23-21-17(3)25(4)26(18-10-6-5-7-11-18)22(21)24-19-12-8-9-13-20(19)28;/h5-14,27-28H,1-4H3;/b16-14-,23-15+,24-22-; |
| InChIKey | SARMMCHMADVPPZ-YESPKBQGSA-N |
| XLogP | 4.61 |
| TPSA | 75.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.85 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|