C11H12BrNS — CID 102236722
4-(bromomethyl)-4-methyl-2-phenyl-5H-1,3-thiazole (PubChem CID 102236722) has the molecular formula C11H12BrNS and a molecular weight of 270.19 g/mol. Its IUPAC name is 4-(bromomethyl)-4-methyl-2-phenyl-5H-1,3-thiazole.
| Compound Name | 4-(bromomethyl)-4-methyl-2-phenyl-5H-1,3-thiazole |
|---|---|
| PubChem CID | 102236722 |
| Molecular Formula | C11H12BrNS |
| Molecular Weight | 270.19 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | 4-(bromomethyl)-4-methyl-2-phenyl-5H-1,3-thiazole |
| SMILES | CC1(CBr)CSC(c2ccccc2)=N1 |
| InChI | InChI=1S/C11H12BrNS/c1-11(7-12)8-14-10(13-11)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| InChIKey | CEBGVCPGIPEEHJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.19 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|