C44H36N2S2 — CID 135250492
2-[4-[9-[4-(4,4-dimethyl-5H-1,3-thiazol-2-yl)phenyl]benzo[b]triphenylen-14-yl]phenyl]-4,4-dimethyl-5H-1,3-thiazole (PubChem CID 135250492) has the molecular formula C44H36N2S2 and a molecular weight of 656.92 g/mol. Its IUPAC name is 2-[4-[9-[4-(4,4-dimethyl-5H-1,3-thiazol-2-yl)phenyl]benzo[b]triphenylen-14-yl]phenyl]-4,4-dimethyl-5H-1,3-thiazole.
| Compound Name | 2-[4-[9-[4-(4,4-dimethyl-5H-1,3-thiazol-2-yl)phenyl]benzo[b]triphenylen-14-yl]phenyl]-4,4-dimethyl-5H-1,3-thiazole |
|---|---|
| PubChem CID | 135250492 |
| Molecular Formula | C44H36N2S2 |
| Molecular Weight | 656.92 g/mol |
| Exact Mass | 656.23 |
| IUPAC Name | 2-[4-[9-[4-(4,4-dimethyl-5H-1,3-thiazol-2-yl)phenyl]benzo[b]triphenylen-14-yl]phenyl]-4,4-dimethyl-5H-1,3-thiazole |
| SMILES | CC1(C)CSC(c2ccc(-c3c4ccccc4c(-c4ccc(C5=NC(C)(C)CS5)cc4)c4c5ccccc5c5ccccc5c34)cc2)=N1 |
| InChI | InChI=1S/C44H36N2S2/c1-43(2)25-47-41(45-43)29-21-17-27(18-22-29)37-35-15-9-10-16-36(35)38(28-19-23-30(24-20-28)42-46-44(3,4)26-48-42)40-34-14-8-6-12-32(34)31-11-5-7-13-33(31)39(37)40/h5-24H,25-26H2,1-4H3 |
| InChIKey | XZRTWNCTFHAZTG-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.92 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|