C12H15NOS — CID 139069527
(4S)-4-ethyl-2-phenyl-5,6-dihydro-1,3-thiazin-4-ol (PubChem CID 139069527) has the molecular formula C12H15NOS and a molecular weight of 221.33 g/mol. Its IUPAC name is (4S)-4-ethyl-2-phenyl-5,6-dihydro-1,3-thiazin-4-ol.
| Compound Name | (4S)-4-ethyl-2-phenyl-5,6-dihydro-1,3-thiazin-4-ol |
|---|---|
| PubChem CID | 139069527 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | (4S)-4-ethyl-2-phenyl-5,6-dihydro-1,3-thiazin-4-ol |
| SMILES | CC[C@]1(O)CCSC(c2ccccc2)=N1 |
| InChI | InChI=1S/C12H15NOS/c1-2-12(14)8-9-15-11(13-12)10-6-4-3-5-7-10/h3-7,14H,2,8-9H2,1H3/t12-/m0/s1 |
| InChIKey | ZBXCSBYFKOANIR-LBPRGKRZSA-N |
| XLogP | 2.67 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |