C13H11ClN2OS2 — CID 10519052
4-(chloromethyl)-2-(2-phenyl-1,3-thiazol-4-yl)-5H-1,3-thiazol-4-ol (PubChem CID 10519052) has the molecular formula C13H11ClN2OS2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(2-phenyl-1,3-thiazol-4-yl)-5H-1,3-thiazol-4-ol.
| Compound Name | 4-(chloromethyl)-2-(2-phenyl-1,3-thiazol-4-yl)-5H-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 10519052 |
| Molecular Formula | C13H11ClN2OS2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 4-(chloromethyl)-2-(2-phenyl-1,3-thiazol-4-yl)-5H-1,3-thiazol-4-ol |
| SMILES | OC1(CCl)CSC(c2csc(-c3ccccc3)n2)=N1 |
| InChI | InChI=1S/C13H11ClN2OS2/c14-7-13(17)8-19-12(16-13)10-6-18-11(15-10)9-4-2-1-3-5-9/h1-6,17H,7-8H2 |
| InChIKey | UFCGWWGJYWKKTH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|