C35H29NO2S — CID 102237118
1-(4-methylphenyl)sulfonyl-7-naphthalen-1-yl-3,5-diphenyl-2,3-dihydroazepine (PubChem CID 102237118) has the molecular formula C35H29NO2S and a molecular weight of 527.69 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-7-naphthalen-1-yl-3,5-diphenyl-2,3-dihydroazepine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-7-naphthalen-1-yl-3,5-diphenyl-2,3-dihydroazepine |
|---|---|
| PubChem CID | 102237118 |
| Molecular Formula | C35H29NO2S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-7-naphthalen-1-yl-3,5-diphenyl-2,3-dihydroazepine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(c3ccccc3)C=C(c3ccccc3)C=C2c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C35H29NO2S/c1-26-19-21-32(22-20-26)39(37,38)36-25-31(28-13-6-3-7-14-28)23-30(27-11-4-2-5-12-27)24-35(36)34-18-10-16-29-15-8-9-17-33(29)34/h2-24,31H,25H2,1H3 |
| InChIKey | ZYEHJLKELLOLNP-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |