C33H25F2NO2S — CID 154715052
(2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-naphthalen-1-yl-2,3-dihydropyrrole (PubChem CID 154715052) has the molecular formula C33H25F2NO2S and a molecular weight of 537.63 g/mol. Its IUPAC name is (2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-naphthalen-1-yl-2,3-dihydropyrrole.
| Compound Name | (2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-naphthalen-1-yl-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 154715052 |
| Molecular Formula | C33H25F2NO2S |
| Molecular Weight | 537.63 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | (2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-naphthalen-1-yl-2,3-dihydropyrrole |
| SMILES | Cc1ccc(S(=O)(=O)N2C(c3ccc(F)cc3)=C(c3ccc(F)cc3)C[C@@H]2c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C33H25F2NO2S/c1-22-9-19-28(20-10-22)39(37,38)36-32(30-8-4-6-23-5-2-3-7-29(23)30)21-31(24-11-15-26(34)16-12-24)33(36)25-13-17-27(35)18-14-25/h2-20,32H,21H2,1H3/t32-/m1/s1 |
| InChIKey | ZRAXKUNZILQVGW-JGCGQSQUSA-N |
| XLogP | 8.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.63 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|