C11H10O — CID 102237630
1,3-diethynyl-2-(methoxymethyl)cyclopenta-1,3-diene (PubChem CID 102237630) has the molecular formula C11H10O and a molecular weight of 158.20 g/mol. Its IUPAC name is 1,3-diethynyl-2-(methoxymethyl)cyclopenta-1,3-diene.
| Compound Name | 1,3-diethynyl-2-(methoxymethyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 102237630 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 1,3-diethynyl-2-(methoxymethyl)cyclopenta-1,3-diene |
| SMILES | C#CC1=CCC(C#C)=C1COC |
| InChI | InChI=1S/C11H10O/c1-4-9-6-7-10(5-2)11(9)8-12-3/h1-2,6H,7-8H2,3H3 |
| InChIKey | CJUZGADPZDNXKP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|