C32H52O5 — CID 102237718
[(3E,7E)-1-[(1S,2S,5Z,6R)-2-hydroxy-6-(3-hydroxypropyl)-1,2-dimethyl-5-(1-oxopropan-2-ylidene)cyclohexyl]-4,8,12-trimethyltrideca-3,7,11-trien-5-yl] acetate (PubChem CID 102237718) has the molecular formula C32H52O5 and a molecular weight of 516.76 g/mol. Its IUPAC name is [(3E,7E)-1-[(1S,2S,5Z,6R)-2-hydroxy-6-(3-hydroxypropyl)-1,2-dimethyl-5-(1-oxopropan-2-ylidene)cyclohexyl]-4,8,12-trimethyltrideca-3,7,11-trien-5-yl] acetate.
| Compound Name | [(3E,7E)-1-[(1S,2S,5Z,6R)-2-hydroxy-6-(3-hydroxypropyl)-1,2-dimethyl-5-(1-oxopropan-2-ylidene)cyclohexyl]-4,8,12-trimethyltrideca-3,7,11-trien-5-yl] acetate |
|---|---|
| PubChem CID | 102237718 |
| Molecular Formula | C32H52O5 |
| Molecular Weight | 516.76 g/mol |
| Exact Mass | 516.38 |
| IUPAC Name | [(3E,7E)-1-[(1S,2S,5Z,6R)-2-hydroxy-6-(3-hydroxypropyl)-1,2-dimethyl-5-(1-oxopropan-2-ylidene)cyclohexyl]-4,8,12-trimethyltrideca-3,7,11-trien-5-yl] acetate |
| SMILES | CC(=O)OC(C/C=C(\C)CCC=C(C)C)/C(C)=C/CC[C@@]1(C)[C@H](CCCO)/C(=C(/C)C=O)CC[C@]1(C)O |
| InChI | InChI=1S/C32H52O5/c1-23(2)12-9-13-24(3)16-17-30(37-27(6)35)25(4)14-10-19-31(7)29(15-11-21-33)28(26(5)22-34)18-20-32(31,8)36/h12,14,16,22,29-30,33,36H,9-11,13,15,17-21H2,1-8H3/b24-16+,25-14+,28-26-/t29-,30?,31+,32+/m1/s1 |
| InChIKey | UMUGWPGRUHYSOT-UPHPHGRXSA-N |
| XLogP | 7.18 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.76 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|