C40H70O4 — CID 162944799
3-[3-hydroxy-2,3-dimethyl-6-(1-oxopropan-2-ylidene)-2-(4,8,12-trimethyltrideca-3,7-dienyl)cyclohexyl]propyl decanoate (PubChem CID 162944799) has the molecular formula C40H70O4 and a molecular weight of 615.00 g/mol. Its IUPAC name is 3-[3-hydroxy-2,3-dimethyl-6-(1-oxopropan-2-ylidene)-2-(4,8,12-trimethyltrideca-3,7-dienyl)cyclohexyl]propyl decanoate.
| Compound Name | 3-[3-hydroxy-2,3-dimethyl-6-(1-oxopropan-2-ylidene)-2-(4,8,12-trimethyltrideca-3,7-dienyl)cyclohexyl]propyl decanoate |
|---|---|
| PubChem CID | 162944799 |
| Molecular Formula | C40H70O4 |
| Molecular Weight | 615.00 g/mol |
| Exact Mass | 614.53 |
| IUPAC Name | 3-[3-hydroxy-2,3-dimethyl-6-(1-oxopropan-2-ylidene)-2-(4,8,12-trimethyltrideca-3,7-dienyl)cyclohexyl]propyl decanoate |
| SMILES | CCCCCCCCCC(=O)OCCCC1C(=C(C)C=O)CCC(C)(O)C1(C)CCC=C(C)CCC=C(C)CCCC(C)C |
| InChI | InChI=1S/C40H70O4/c1-9-10-11-12-13-14-15-26-38(42)44-30-19-25-37-36(35(6)31-41)27-29-40(8,43)39(37,7)28-18-24-34(5)23-17-22-33(4)21-16-20-32(2)3/h22,24,31-32,37,43H,9-21,23,25-30H2,1-8H3 |
| InChIKey | JZWIUMRLWZVVKJ-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.00 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|