C40H68O4 — CID 162997086
3-[(1S,2R,3R,6Z)-2-[(3E,5R,7E)-5-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,3-dimethyl-6-(1-oxopropan-2-ylidene)cyclohexyl]propyl decanoate (PubChem CID 162997086) has the molecular formula C40H68O4 and a molecular weight of 612.98 g/mol. Its IUPAC name is 3-[(1S,2R,3R,6Z)-2-[(3E,5R,7E)-5-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,3-dimethyl-6-(1-oxopropan-2-ylidene)cyclohexyl]propyl decanoate.
| Compound Name | 3-[(1S,2R,3R,6Z)-2-[(3E,5R,7E)-5-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,3-dimethyl-6-(1-oxopropan-2-ylidene)cyclohexyl]propyl decanoate |
|---|---|
| PubChem CID | 162997086 |
| Molecular Formula | C40H68O4 |
| Molecular Weight | 612.98 g/mol |
| Exact Mass | 612.51 |
| IUPAC Name | 3-[(1S,2R,3R,6Z)-2-[(3E,5R,7E)-5-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,3-dimethyl-6-(1-oxopropan-2-ylidene)cyclohexyl]propyl decanoate |
| SMILES | CCCCCCCCCC(=O)OCCC[C@@H]1/C(=C(/C)C=O)CC[C@@H](C)[C@@]1(C)CC/C=C(\C)[C@H](O)C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C40H68O4/c1-9-10-11-12-13-14-15-23-39(43)44-29-18-22-37-36(34(6)30-41)26-25-35(7)40(37,8)28-17-21-33(5)38(42)27-24-32(4)20-16-19-31(2)3/h19,21,24,30,35,37-38,42H,9-18,20,22-23,25-29H2,1-8H3/b32-24+,33-21+,36-34-/t35-,37-,38-,40-/m1/s1 |
| InChIKey | RHWGELGQTCGCNJ-RMJWRXKISA-N |
| XLogP | 11.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.98 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|