C30H50O4 — CID 98543667
(2E)-2-[(2R,3R,4R)-4-hydroxy-2-(3-hydroxypropyl)-3-[(3E,7Z,10R)-10-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dimethylcyclohexylidene]propanal (PubChem CID 98543667) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is (2E)-2-[(2R,3R,4R)-4-hydroxy-2-(3-hydroxypropyl)-3-[(3E,7Z,10R)-10-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dimethylcyclohexylidene]propanal.
| Compound Name | (2E)-2-[(2R,3R,4R)-4-hydroxy-2-(3-hydroxypropyl)-3-[(3E,7Z,10R)-10-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dimethylcyclohexylidene]propanal |
|---|---|
| PubChem CID | 98543667 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | (2E)-2-[(2R,3R,4R)-4-hydroxy-2-(3-hydroxypropyl)-3-[(3E,7Z,10R)-10-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dimethylcyclohexylidene]propanal |
| SMILES | CC(C)=C[C@H](O)C/C(C)=C\CC/C(C)=C/CC[C@]1(C)[C@H](CCCO)/C(=C(\C)C=O)CC[C@@]1(C)O |
| InChI | InChI=1S/C30H50O4/c1-22(2)19-26(33)20-24(4)12-8-11-23(3)13-9-16-29(6)28(14-10-18-31)27(25(5)21-32)15-17-30(29,7)34/h12-13,19,21,26,28,31,33-34H,8-11,14-18,20H2,1-7H3/b23-13+,24-12-,27-25+/t26-,28+,29+,30+/m0/s1 |
| InChIKey | CMKAMRUVQONAPO-LCDRBOGPSA-N |
| XLogP | 6.61 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|