C17H19NO4S — CID 102239309
[6-(methylamino)-7-oxo-3-propan-2-ylcyclohepta-1,3,5-trien-1-yl] benzenesulfonate (PubChem CID 102239309) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is [6-(methylamino)-7-oxo-3-propan-2-ylcyclohepta-1,3,5-trien-1-yl] benzenesulfonate.
| Compound Name | [6-(methylamino)-7-oxo-3-propan-2-ylcyclohepta-1,3,5-trien-1-yl] benzenesulfonate |
|---|---|
| PubChem CID | 102239309 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | [6-(methylamino)-7-oxo-3-propan-2-ylcyclohepta-1,3,5-trien-1-yl] benzenesulfonate |
| SMILES | CNc1ccc(C(C)C)cc(OS(=O)(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C17H19NO4S/c1-12(2)13-9-10-15(18-3)17(19)16(11-13)22-23(20,21)14-7-5-4-6-8-14/h4-12H,1-3H3,(H,18,19) |
| InChIKey | OOTCERZEXZWEPG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|