C19H23NO4S — CID 102370795
[6-(dimethylamino)-7-oxo-3-propan-2-ylcyclohepta-1,3,5-trien-1-yl] 4-methylbenzenesulfonate (PubChem CID 102370795) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is [6-(dimethylamino)-7-oxo-3-propan-2-ylcyclohepta-1,3,5-trien-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [6-(dimethylamino)-7-oxo-3-propan-2-ylcyclohepta-1,3,5-trien-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102370795 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | [6-(dimethylamino)-7-oxo-3-propan-2-ylcyclohepta-1,3,5-trien-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cc(C(C)C)ccc(N(C)C)c2=O)cc1 |
| InChI | InChI=1S/C19H23NO4S/c1-13(2)15-8-11-17(20(4)5)19(21)18(12-15)24-25(22,23)16-9-6-14(3)7-10-16/h6-13H,1-5H3 |
| InChIKey | JCAOXNJNEGPIBY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|