C24H30O7 — CID 102239567
1-[(2S,3S)-2-(3,4-dimethoxyphenyl)-6-(methoxymethoxy)-3-methyl-2,3-dihydro-1-benzofuran-5-yl]propyl acetate (PubChem CID 102239567) has the molecular formula C24H30O7 and a molecular weight of 430.50 g/mol. Its IUPAC name is 1-[(2S,3S)-2-(3,4-dimethoxyphenyl)-6-(methoxymethoxy)-3-methyl-2,3-dihydro-1-benzofuran-5-yl]propyl acetate.
| Compound Name | 1-[(2S,3S)-2-(3,4-dimethoxyphenyl)-6-(methoxymethoxy)-3-methyl-2,3-dihydro-1-benzofuran-5-yl]propyl acetate |
|---|---|
| PubChem CID | 102239567 |
| Molecular Formula | C24H30O7 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1-[(2S,3S)-2-(3,4-dimethoxyphenyl)-6-(methoxymethoxy)-3-methyl-2,3-dihydro-1-benzofuran-5-yl]propyl acetate |
| SMILES | CCC(OC(C)=O)c1cc2c(cc1OCOC)O[C@H](c1ccc(OC)c(OC)c1)[C@H]2C |
| InChI | InChI=1S/C24H30O7/c1-7-19(30-15(3)25)18-11-17-14(2)24(31-22(17)12-21(18)29-13-26-4)16-8-9-20(27-5)23(10-16)28-6/h8-12,14,19,24H,7,13H2,1-6H3/t14-,19?,24-/m0/s1 |
| InChIKey | QYEZTVHHWZPWQS-LEJHENFRSA-N |
| XLogP | 4.94 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|